C7H15NO2 — CID 123616838
5-amino-2,2-dimethyloxan-4-ol (PubChem CID 123616838) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is 5-amino-2,2-dimethyloxan-4-ol.
| Compound Name | 5-amino-2,2-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 123616838 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 5-amino-2,2-dimethyloxan-4-ol |
| SMILES | CC1(C)CC(O)C(N)CO1 |
| InChI | InChI=1S/C7H15NO2/c1-7(2)3-6(9)5(8)4-10-7/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | FPLFEOSCMSVSJN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |