About (4S,5S)-5-amino-2,2-dimethyloxan-4-ol
(4S,5S)-5-amino-2,2-dimethyloxan-4-ol (PubChem CID 118036455) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is (4S,5S)-5-amino-2,2-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | (4S,5S)-5-amino-2,2-dimethyloxan-4-ol |
| PubChem CID | 118036455 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (4S,5S)-5-amino-2,2-dimethyloxan-4-ol |
| SMILES | CC1(C)C[C@H](O)[C@@H](N)CO1 |
| InChI | InChI=1S/C7H15NO2/c1-7(2)3-6(9)5(8)4-10-7/h5-6,9H,3-4,8H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | FPLFEOSCMSVSJN-WDSKDSINSA-N |
| XLogP | -0.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5S)-5-amino-2,2-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-5-amino-2,2-dimethyloxan-4-ol?
The IUPAC name of (4S,5S)-5-amino-2,2-dimethyloxan-4-ol (CID 118036455) is (4S,5S)-5-amino-2,2-dimethyloxan-4-ol.
What is the SMILES notation for (4S,5S)-5-amino-2,2-dimethyloxan-4-ol?
The canonical SMILES for (4S,5S)-5-amino-2,2-dimethyloxan-4-ol is CC1(C)C[C@H](O)[C@@H](N)CO1.
What is the InChIKey of (4S,5S)-5-amino-2,2-dimethyloxan-4-ol?
The InChIKey is FPLFEOSCMSVSJN-WDSKDSINSA-N. The full InChI is InChI=1S/C7H15NO2/c1-7(2)3-6(9)5(8)4-10-7/h5-6,9H,3-4,8H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of (4S,5S)-5-amino-2,2-dimethyloxan-4-ol?
(4S,5S)-5-amino-2,2-dimethyloxan-4-ol has a molecular weight of 145.20 g/mol, XLogP of -0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-5-amino-2,2-dimethyloxan-4-ol is sourced from PubChem (CID 118036455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).