C12H24NO3+ — CID 1401343
(4R,5S)-2,2-dimethyl-5-(morpholin-4-ium-4-ylmethyl)oxan-4-ol (PubChem CID 1401343) has the molecular formula C12H24NO3+ and a molecular weight of 230.33 g/mol. Its IUPAC name is (4R,5S)-2,2-dimethyl-5-(morpholin-4-ium-4-ylmethyl)oxan-4-ol.
| Compound Name | (4R,5S)-2,2-dimethyl-5-(morpholin-4-ium-4-ylmethyl)oxan-4-ol |
|---|---|
| PubChem CID | 1401343 |
| Molecular Formula | C12H24NO3+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (4R,5S)-2,2-dimethyl-5-(morpholin-4-ium-4-ylmethyl)oxan-4-ol |
| SMILES | CC1(C)C[C@@H](O)[C@@H](C[NH+]2CCOCC2)CO1 |
| InChI | InChI=1S/C12H23NO3/c1-12(2)7-11(14)10(9-16-12)8-13-3-5-15-6-4-13/h10-11,14H,3-9H2,1-2H3/p+1/t10-,11+/m0/s1 |
| InChIKey | TYQFREFRVKDNGT-WDEREUQCSA-O |
| XLogP | -0.92 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |