C11H16O5-2 — CID 6954943
(4R,5S)-5-(2-carboxylatoethyl)-2,2-dimethyloxane-4-carboxylate (PubChem CID 6954943) has the molecular formula C11H16O5-2 and a molecular weight of 228.24 g/mol. Its IUPAC name is (4R,5S)-5-(2-carboxylatoethyl)-2,2-dimethyloxane-4-carboxylate.
| Compound Name | (4R,5S)-5-(2-carboxylatoethyl)-2,2-dimethyloxane-4-carboxylate |
|---|---|
| PubChem CID | 6954943 |
| Molecular Formula | C11H16O5-2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (4R,5S)-5-(2-carboxylatoethyl)-2,2-dimethyloxane-4-carboxylate |
| SMILES | CC1(C)C[C@@H](C(=O)[O-])[C@H](CCC(=O)[O-])CO1 |
| InChI | InChI=1S/C11H18O5/c1-11(2)5-8(10(14)15)7(6-16-11)3-4-9(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)(H,14,15)/p-2/t7-,8-/m1/s1 |
| InChIKey | FJFJDSUKLADSJK-HTQZYQBOSA-L |
| XLogP | -1.30 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |