About zinc;butanoate;2-methanidyloxirane
zinc;butanoate;2-methanidyloxirane (PubChem CID 174880277) has the molecular formula C7H12O3Zn
and a molecular weight of 209.56 g/mol. Its IUPAC name is zinc;butanoate;2-methanidyloxirane.
Molecular Properties
| Compound Name | zinc;butanoate;2-methanidyloxirane |
| PubChem CID | 174880277 |
| Molecular Formula | C7H12O3Zn |
| Molecular Weight | 209.56 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | zinc;butanoate;2-methanidyloxirane |
| SMILES | CCCC(=O)[O-].[CH2-]C1CO1.[Zn+2] |
| InChI | InChI=1S/C4H8O2.C3H5O.Zn/c1-2-3-4(5)6;1-3-2-4-3;/h2-3H2,1H3,(H,5,6);3H,1-2H2;/q;-1;+2/p-1 |
| InChIKey | RINMFQJYYSAFTH-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.56 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze zinc;butanoate;2-methanidyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;butanoate;2-methanidyloxirane?
The IUPAC name of zinc;butanoate;2-methanidyloxirane (CID 174880277) is zinc;butanoate;2-methanidyloxirane.
What is the SMILES notation for zinc;butanoate;2-methanidyloxirane?
The canonical SMILES for zinc;butanoate;2-methanidyloxirane is CCCC(=O)[O-].[CH2-]C1CO1.[Zn+2].
What is the InChIKey of zinc;butanoate;2-methanidyloxirane?
The InChIKey is RINMFQJYYSAFTH-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.C3H5O.Zn/c1-2-3-4(5)6;1-3-2-4-3;/h2-3H2,1H3,(H,5,6);3H,1-2H2;/q;-1;+2/p-1.
What are the key properties of zinc;butanoate;2-methanidyloxirane?
zinc;butanoate;2-methanidyloxirane has a molecular weight of 209.56 g/mol, XLogP of -0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;butanoate;2-methanidyloxirane is sourced from PubChem (CID 174880277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).