C7H13NO2 — CID 163951788
2,2-dimethyl-4-(nitrosomethyl)oxolane (PubChem CID 163951788) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2,2-dimethyl-4-(nitrosomethyl)oxolane.
| Compound Name | 2,2-dimethyl-4-(nitrosomethyl)oxolane |
|---|---|
| PubChem CID | 163951788 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2,2-dimethyl-4-(nitrosomethyl)oxolane |
| SMILES | CC1(C)CC(CN=O)CO1 |
| InChI | InChI=1S/C7H13NO2/c1-7(2)3-6(4-8-9)5-10-7/h6H,3-5H2,1-2H3 |
| InChIKey | RZYJZXGQEDOGIB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |