About (5,5-dimethyloxolan-3-yl) ethanesulfonate
(5,5-dimethyloxolan-3-yl) ethanesulfonate (PubChem CID 172709984) has the molecular formula C8H16O4S
and a molecular weight of 208.28 g/mol. Its IUPAC name is (5,5-dimethyloxolan-3-yl) ethanesulfonate.
Molecular Properties
| Compound Name | (5,5-dimethyloxolan-3-yl) ethanesulfonate |
| PubChem CID | 172709984 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (5,5-dimethyloxolan-3-yl) ethanesulfonate |
| SMILES | CCS(=O)(=O)OC1COC(C)(C)C1 |
| InChI | InChI=1S/C8H16O4S/c1-4-13(9,10)12-7-5-8(2,3)11-6-7/h7H,4-6H2,1-3H3 |
| InChIKey | FCRKXHICOSKASZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5,5-dimethyloxolan-3-yl) ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethyloxolan-3-yl) ethanesulfonate?
The IUPAC name of (5,5-dimethyloxolan-3-yl) ethanesulfonate (CID 172709984) is (5,5-dimethyloxolan-3-yl) ethanesulfonate.
What is the SMILES notation for (5,5-dimethyloxolan-3-yl) ethanesulfonate?
The canonical SMILES for (5,5-dimethyloxolan-3-yl) ethanesulfonate is CCS(=O)(=O)OC1COC(C)(C)C1.
What is the InChIKey of (5,5-dimethyloxolan-3-yl) ethanesulfonate?
The InChIKey is FCRKXHICOSKASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4S/c1-4-13(9,10)12-7-5-8(2,3)11-6-7/h7H,4-6H2,1-3H3.
What are the key properties of (5,5-dimethyloxolan-3-yl) ethanesulfonate?
(5,5-dimethyloxolan-3-yl) ethanesulfonate has a molecular weight of 208.28 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethyloxolan-3-yl) ethanesulfonate is sourced from PubChem (CID 172709984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).