C11H22O4 — CID 123899410
2-(5,5-dimethyloxolan-3-yl)oxy-2-propan-2-yloxyethanol (PubChem CID 123899410) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-(5,5-dimethyloxolan-3-yl)oxy-2-propan-2-yloxyethanol.
| Compound Name | 2-(5,5-dimethyloxolan-3-yl)oxy-2-propan-2-yloxyethanol |
|---|---|
| PubChem CID | 123899410 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(5,5-dimethyloxolan-3-yl)oxy-2-propan-2-yloxyethanol |
| SMILES | CC(C)OC(CO)OC1COC(C)(C)C1 |
| InChI | InChI=1S/C11H22O4/c1-8(2)14-10(6-12)15-9-5-11(3,4)13-7-9/h8-10,12H,5-7H2,1-4H3 |
| InChIKey | ZVQHWSBKDRGRPX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|