C12H24O4 — CID 123155516
2-butan-2-yloxy-2-(5,5-dimethyloxolan-3-yl)oxyethanol (PubChem CID 123155516) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-butan-2-yloxy-2-(5,5-dimethyloxolan-3-yl)oxyethanol.
| Compound Name | 2-butan-2-yloxy-2-(5,5-dimethyloxolan-3-yl)oxyethanol |
|---|---|
| PubChem CID | 123155516 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-butan-2-yloxy-2-(5,5-dimethyloxolan-3-yl)oxyethanol |
| SMILES | CCC(C)OC(CO)OC1COC(C)(C)C1 |
| InChI | InChI=1S/C12H24O4/c1-5-9(2)15-11(7-13)16-10-6-12(3,4)14-8-10/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | BRQDVFQELIYIFF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|