C12H21NO2 — CID 131197269
N-(5,5-dimethyloxolan-3-yl)-N,3-dimethylbut-2-enamide (PubChem CID 131197269) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N-(5,5-dimethyloxolan-3-yl)-N,3-dimethylbut-2-enamide.
| Compound Name | N-(5,5-dimethyloxolan-3-yl)-N,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 131197269 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-(5,5-dimethyloxolan-3-yl)-N,3-dimethylbut-2-enamide |
| SMILES | CC(C)=CC(=O)N(C)C1COC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO2/c1-9(2)6-11(14)13(5)10-7-12(3,4)15-8-10/h6,10H,7-8H2,1-5H3 |
| InChIKey | OHIKNBINGPVRPP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|