C9H16N2O4 — CID 131218860
2-[(5,5-dimethyloxolan-3-yl)carbamoylamino]acetic acid (PubChem CID 131218860) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-3-yl)carbamoylamino]acetic acid.
| Compound Name | 2-[(5,5-dimethyloxolan-3-yl)carbamoylamino]acetic acid |
|---|---|
| PubChem CID | 131218860 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-3-yl)carbamoylamino]acetic acid |
| SMILES | CC1(C)CC(NC(=O)NCC(=O)O)CO1 |
| InChI | InChI=1S/C9H16N2O4/c1-9(2)3-6(5-15-9)11-8(14)10-4-7(12)13/h6H,3-5H2,1-2H3,(H,12,13)(H2,10,11,14) |
| InChIKey | FBYCOCZJNLBKMC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |