4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid

C14H16FNO4 — CID 136552063

IUPAC4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid
SMILESCC1(C)CC(NC(=O)c2ccc(C(=O)O)cc2F)CO1
InChIInChI=1S/C14H16FNO4/c1-14(2)6-9(7-20-14)16-12(17)10-4-3-8(13(18)19)5-11(10)15/h3-5,9H,6-7H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyVRCNPXFQZXHEOU-UHFFFAOYSA-N
MW281.28 g/mol
LogP1.82
Rot. Bonds3

About 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid

4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid (PubChem CID 136552063) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid.

Molecular Properties

Compound Name4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid
PubChem CID136552063
Molecular FormulaC14H16FNO4
Molecular Weight281.28 g/mol
Exact Mass281.11
IUPAC Name4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid
SMILESCC1(C)CC(NC(=O)c2ccc(C(=O)O)cc2F)CO1
InChIInChI=1S/C14H16FNO4/c1-14(2)6-9(7-20-14)16-12(17)10-4-3-8(13(18)19)5-11(10)15/h3-5,9H,6-7H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyVRCNPXFQZXHEOU-UHFFFAOYSA-N
XLogP1.82
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.28
LogP ≤ 51.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid?
The IUPAC name of 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid (CID 136552063) is 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid.
What is the SMILES notation for 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid?
The canonical SMILES for 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid is CC1(C)CC(NC(=O)c2ccc(C(=O)O)cc2F)CO1.
What is the InChIKey of 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid?
The InChIKey is VRCNPXFQZXHEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO4/c1-14(2)6-9(7-20-14)16-12(17)10-4-3-8(13(18)19)5-11(10)15/h3-5,9H,6-7H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid?
4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid has a molecular weight of 281.28 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid is sourced from PubChem (CID 136552063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).