C14H16FNO4 — CID 136552063
4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid (PubChem CID 136552063) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 136552063 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-[(5,5-dimethyloxolan-3-yl)carbamoyl]-3-fluorobenzoic acid |
| SMILES | CC1(C)CC(NC(=O)c2ccc(C(=O)O)cc2F)CO1 |
| InChI | InChI=1S/C14H16FNO4/c1-14(2)6-9(7-20-14)16-12(17)10-4-3-8(13(18)19)5-11(10)15/h3-5,9H,6-7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | VRCNPXFQZXHEOU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |