C16H23NO2 — CID 720207
6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline (PubChem CID 720207) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline.
| Compound Name | 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline |
|---|---|
| PubChem CID | 720207 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)C(C(C)C)=NC(C)(C)C2 |
| InChI | InChI=1S/C16H23NO2/c1-10(2)15-12-8-14(19-6)13(18-5)7-11(12)9-16(3,4)17-15/h7-8,10H,9H2,1-6H3 |
| InChIKey | RETZWKAIXPOBFZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |