About 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline
6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline (PubChem CID 720207) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline |
| PubChem CID | 720207 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)C(C(C)C)=NC(C)(C)C2 |
| InChI | InChI=1S/C16H23NO2/c1-10(2)15-12-8-14(19-6)13(18-5)7-11(12)9-16(3,4)17-15/h7-8,10H,9H2,1-6H3 |
| InChIKey | RETZWKAIXPOBFZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline?
The IUPAC name of 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline (CID 720207) is 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline.
What is the SMILES notation for 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline?
The canonical SMILES for 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline is COc1cc2c(cc1OC)C(C(C)C)=NC(C)(C)C2.
What is the InChIKey of 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline?
The InChIKey is RETZWKAIXPOBFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-10(2)15-12-8-14(19-6)13(18-5)7-11(12)9-16(3,4)17-15/h7-8,10H,9H2,1-6H3.
What are the key properties of 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline?
6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline has a molecular weight of 261.37 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3,3-dimethyl-1-propan-2-yl-4H-isoquinoline is sourced from PubChem (CID 720207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).