About (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate
(3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (PubChem CID 7203153) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| PubChem CID | 7203153 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| SMILES | CC(C)(C)C(=O)COC(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,3)8(14)6-17-10(16)7-4-5-9(15)13-12-7/h4-6H2,1-3H3,(H,13,15) |
| InChIKey | AGQWPDCZXKRQMW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The IUPAC name of (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (CID 7203153) is (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
What is the SMILES notation for (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The canonical SMILES for (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate is CC(C)(C)C(=O)COC(=O)C1=NNC(=O)CC1.
What is the InChIKey of (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The InChIKey is AGQWPDCZXKRQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-11(2,3)8(14)6-17-10(16)7-4-5-9(15)13-12-7/h4-6H2,1-3H3,(H,13,15).
What are the key properties of (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
(3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate has a molecular weight of 240.26 g/mol, XLogP of 0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxobutyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate is sourced from PubChem (CID 7203153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).