About (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate
(3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (PubChem CID 7937007) has the molecular formula C11H12N4O4
and a molecular weight of 264.24 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| PubChem CID | 7937007 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C11H12N4O4/c1-6(13)7(4-12)9(16)5-19-11(18)8-2-3-10(17)15-14-8/h7,13H,2-3,5H2,1H3,(H,15,17)/b13-6+ |
| InChIKey | RRSOASZBGIVMPG-AWNIVKPZSA-N |
| XLogP | -0.46 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The IUPAC name of (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (CID 7937007) is (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
What is the SMILES notation for (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The canonical SMILES for (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate is [H]/N=C(\C)C(C#N)C(=O)COC(=O)C1=NNC(=O)CC1.
What is the InChIKey of (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
The InChIKey is RRSOASZBGIVMPG-AWNIVKPZSA-N. The full InChI is InChI=1S/C11H12N4O4/c1-6(13)7(4-12)9(16)5-19-11(18)8-2-3-10(17)15-14-8/h7,13H,2-3,5H2,1H3,(H,15,17)/b13-6+.
What are the key properties of (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate?
(3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate has a molecular weight of 264.24 g/mol, XLogP of -0.46, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-4-imino-2-oxopentyl) 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate is sourced from PubChem (CID 7937007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).