C17H19N4O4+ — CID 7204801
ethyl 6-amino-7-(3-hydroxypropyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate (PubChem CID 7204801) has the molecular formula C17H19N4O4+ and a molecular weight of 343.36 g/mol. Its IUPAC name is ethyl 6-amino-7-(3-hydroxypropyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate.
| Compound Name | ethyl 6-amino-7-(3-hydroxypropyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 7204801 |
| Molecular Formula | C17H19N4O4+ |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl 6-amino-7-(3-hydroxypropyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2[n+](CCCO)c1N |
| InChI | InChI=1S/C17H18N4O4/c1-2-25-17(24)11-10-12-15(21(14(11)18)8-5-9-22)19-13-6-3-4-7-20(13)16(12)23/h3-4,6-7,10,18,22H,2,5,8-9H2,1H3/p+1 |
| InChIKey | ZJVHJXQMNLUCRU-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|