C22H24N5O4+ — CID 7013312
6-amino-7-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 7013312) has the molecular formula C22H24N5O4+ and a molecular weight of 422.47 g/mol. Its IUPAC name is 6-amino-7-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | 6-amino-7-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 7013312 |
| Molecular Formula | C22H24N5O4+ |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 6-amino-7-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | CCOCCC[n+]1c(N)c(C(=O)NCc2ccco2)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C22H23N5O4/c1-2-30-11-6-10-27-19(23)16(21(28)24-14-15-7-5-12-31-15)13-17-20(27)25-18-8-3-4-9-26(18)22(17)29/h3-5,7-9,12-13,23H,2,6,10-11,14H2,1H3,(H,24,28)/p+1 |
| InChIKey | BYSLEMKTGXXJON-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|