C19H19FN2O6 — CID 7211789
[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 4-propoxybenzoate (PubChem CID 7211789) has the molecular formula C19H19FN2O6 and a molecular weight of 390.37 g/mol. Its IUPAC name is [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 4-propoxybenzoate.
| Compound Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 7211789 |
| Molecular Formula | C19H19FN2O6 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H19FN2O6/c1-3-10-27-15-7-4-13(5-8-15)19(24)28-12(2)18(23)21-14-6-9-16(20)17(11-14)22(25)26/h4-9,11-12H,3,10H2,1-2H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | RZAOKWNNEGVLCA-LBPRGKRZSA-N |
| XLogP | 3.71 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|