C22H24FN3O7 — CID 42974054
[1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate (PubChem CID 42974054) has the molecular formula C22H24FN3O7 and a molecular weight of 461.45 g/mol. Its IUPAC name is [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate.
| Compound Name | [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42974054 |
| Molecular Formula | C22H24FN3O7 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)OC(C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H24FN3O7/c1-3-4-11-32-17-8-5-15(6-9-17)22(29)24-13-20(27)33-14(2)21(28)25-16-7-10-18(23)19(12-16)26(30)31/h5-10,12,14H,3-4,11,13H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | NGFHGQNRKVOTOS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|