C15H15Cl2NO2 — CID 7218107
(3aR,5R,7aS)-2-(3,5-dichlorophenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 7218107) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is (3aR,5R,7aS)-2-(3,5-dichlorophenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,5R,7aS)-2-(3,5-dichlorophenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7218107 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (3aR,5R,7aS)-2-(3,5-dichlorophenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | C[C@@H]1CC[C@@H]2C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C15H15Cl2NO2/c1-8-2-3-12-13(4-8)15(20)18(14(12)19)11-6-9(16)5-10(17)7-11/h5-8,12-13H,2-4H2,1H3/t8-,12+,13-/m1/s1 |
| InChIKey | CDAVCIQKORJVFJ-OXHMUOHRSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|