C15H14ClNO4 — CID 114391648
3-chloro-5-(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)benzoic acid (PubChem CID 114391648) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is 3-chloro-5-(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)benzoic acid.
| Compound Name | 3-chloro-5-(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 114391648 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-chloro-5-(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)benzoic acid |
| SMILES | CC1CC2C(=O)N(c3cc(Cl)cc(C(=O)O)c3)C(=O)C2C1 |
| InChI | InChI=1S/C15H14ClNO4/c1-7-2-11-12(3-7)14(19)17(13(11)18)10-5-8(15(20)21)4-9(16)6-10/h4-7,11-12H,2-3H2,1H3,(H,20,21) |
| InChIKey | UECXEAHGLHDCLA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|