C16H16ClN3O4S — CID 7220923
ethyl (2R)-4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanoate (PubChem CID 7220923) has the molecular formula C16H16ClN3O4S and a molecular weight of 381.84 g/mol. Its IUPAC name is ethyl (2R)-4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanoate.
| Compound Name | ethyl (2R)-4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanoate |
|---|---|
| PubChem CID | 7220923 |
| Molecular Formula | C16H16ClN3O4S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | ethyl (2R)-4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-ethanimidoyl-3-oxobutanoate |
| SMILES | [H]/N=C(\C)[C@H](C(=O)CSc1nnc(-c2ccc(Cl)cc2)o1)C(=O)OCC |
| InChI | InChI=1S/C16H16ClN3O4S/c1-3-23-15(22)13(9(2)18)12(21)8-25-16-20-19-14(24-16)10-4-6-11(17)7-5-10/h4-7,13,18H,3,8H2,1-2H3/b18-9+/t13-/m1/s1 |
| InChIKey | DVPZTIFBSKNMBN-AGZSBTIMSA-N |
| XLogP | 3.27 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|