C21H21N3O4S — CID 7220922
ethyl (2R)-2-ethanimidoyl-4-[[5-(naphthalen-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 7220922) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is ethyl (2R)-2-ethanimidoyl-4-[[5-(naphthalen-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-ethanimidoyl-4-[[5-(naphthalen-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7220922 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethyl (2R)-2-ethanimidoyl-4-[[5-(naphthalen-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | [H]/N=C(\C)[C@H](C(=O)CSc1nnc(Cc2cccc3ccccc23)o1)C(=O)OCC |
| InChI | InChI=1S/C21H21N3O4S/c1-3-27-20(26)19(13(2)22)17(25)12-29-21-24-23-18(28-21)11-15-9-6-8-14-7-4-5-10-16(14)15/h4-10,19,22H,3,11-12H2,1-2H3/b22-13+/t19-/m1/s1 |
| InChIKey | DCQPECIOKYKCRF-PPRFWAEMSA-N |
| XLogP | 3.69 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|