C15H16N2O2S2 — CID 722190
3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)pentane-2,4-dione (PubChem CID 722190) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)pentane-2,4-dione.
| Compound Name | 3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 722190 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)pentane-2,4-dione |
| SMILES | CC(=O)C(Sc1ncnc2sc3c(c12)CCCC3)C(C)=O |
| InChI | InChI=1S/C15H16N2O2S2/c1-8(18)13(9(2)19)21-15-12-10-5-3-4-6-11(10)20-14(12)16-7-17-15/h7,13H,3-6H2,1-2H3 |
| InChIKey | ADBTYBLDBHWAAR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|