C21H22N2O — CID 7232130
(2R)-3-methyl-2-morpholin-4-yl-2,4-diphenylbut-3-enenitrile (PubChem CID 7232130) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R)-3-methyl-2-morpholin-4-yl-2,4-diphenylbut-3-enenitrile.
| Compound Name | (2R)-3-methyl-2-morpholin-4-yl-2,4-diphenylbut-3-enenitrile |
|---|---|
| PubChem CID | 7232130 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2R)-3-methyl-2-morpholin-4-yl-2,4-diphenylbut-3-enenitrile |
| SMILES | CC(=Cc1ccccc1)[C@](C#N)(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H22N2O/c1-18(16-19-8-4-2-5-9-19)21(17-22,20-10-6-3-7-11-20)23-12-14-24-15-13-23/h2-11,16H,12-15H2,1H3/t21-/m1/s1 |
| InChIKey | FQTXYGOCTWOMRE-OAQYLSRUSA-N |
| XLogP | 3.84 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |