C23H27BrO — CID 7232644
[4-(4-bromophenyl)phenyl]-[(1S,3S)-3-pentylcyclopentyl]methanone (PubChem CID 7232644) has the molecular formula C23H27BrO and a molecular weight of 399.37 g/mol. Its IUPAC name is [4-(4-bromophenyl)phenyl]-[(1S,3S)-3-pentylcyclopentyl]methanone.
| Compound Name | [4-(4-bromophenyl)phenyl]-[(1S,3S)-3-pentylcyclopentyl]methanone |
|---|---|
| PubChem CID | 7232644 |
| Molecular Formula | C23H27BrO |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [4-(4-bromophenyl)phenyl]-[(1S,3S)-3-pentylcyclopentyl]methanone |
| SMILES | CCCCC[C@H]1CC[C@H](C(=O)c2ccc(-c3ccc(Br)cc3)cc2)C1 |
| InChI | InChI=1S/C23H27BrO/c1-2-3-4-5-17-6-7-21(16-17)23(25)20-10-8-18(9-11-20)19-12-14-22(24)15-13-19/h8-15,17,21H,2-7,16H2,1H3/t17-,21-/m0/s1 |
| InChIKey | RRUPLKBAGGEDLS-UWJYYQICSA-N |
| XLogP | 7.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|