C20H27N5O5+2 — CID 7237865
N'-(furan-2-ylmethyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazine-1,4-diium-1-yl]ethyl]oxamide (PubChem CID 7237865) has the molecular formula C20H27N5O5+2 and a molecular weight of 417.47 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazine-1,4-diium-1-yl]ethyl]oxamide.
| Compound Name | N'-(furan-2-ylmethyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazine-1,4-diium-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 7237865 |
| Molecular Formula | C20H27N5O5+2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazine-1,4-diium-1-yl]ethyl]oxamide |
| SMILES | O=C(NCC[NH+]1CC[NH+](Cc2ccc([N+](=O)[O-])cc2)CC1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C20H25N5O5/c26-19(20(27)22-14-18-2-1-13-30-18)21-7-8-23-9-11-24(12-10-23)15-16-3-5-17(6-4-16)25(28)29/h1-6,13H,7-12,14-15H2,(H,21,26)(H,22,27)/p+2 |
| InChIKey | NTPKTVQIQPMTQB-UHFFFAOYSA-P |
| XLogP | -2.10 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|