C19H17NO4 — CID 723971
(3,5-dimethylphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 723971) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (3,5-dimethylphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 723971 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (3,5-dimethylphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1cc(C)cc(OC(=O)CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H17NO4/c1-12-9-13(2)11-14(10-12)24-17(21)7-8-20-18(22)15-5-3-4-6-16(15)19(20)23/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | IAJUAVJMBGIKEG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|