C18H20N2O4 — CID 7240366
(2S)-2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-N-(4-methoxyphenyl)propanamide (PubChem CID 7240366) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-N-(4-methoxyphenyl)propanamide.
| Compound Name | (2S)-2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 7240366 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S)-2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@H](C)Oc2ccc(/C(C)=N/O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-12(20-22)14-4-8-17(9-5-14)24-13(2)18(21)19-15-6-10-16(23-3)11-7-15/h4-11,13,22H,1-3H3,(H,19,21)/b20-12+/t13-/m0/s1 |
| InChIKey | ZOHHXJQOQLECCJ-DZUMZMOTSA-N |
| XLogP | 3.30 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|