C10H7F2N3O4S — CID 7244628
N-(3,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 7244628) has the molecular formula C10H7F2N3O4S and a molecular weight of 303.25 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7244628 |
| Molecular Formula | C10H7F2N3O4S |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-(3,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)Nc2ccc(F)c(F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H7F2N3O4S/c11-6-2-1-5(3-7(6)12)15-20(18,19)8-4-13-10(17)14-9(8)16/h1-4,15H,(H2,13,14,16,17) |
| InChIKey | HZRDAUSJGWLTTB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |