C10H8FN3O4S — CID 7244632
N-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 7244632) has the molecular formula C10H8FN3O4S and a molecular weight of 285.26 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7244632 |
| Molecular Formula | C10H8FN3O4S |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)Nc2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H8FN3O4S/c11-6-1-3-7(4-2-6)14-19(17,18)8-5-12-10(16)13-9(8)15/h1-5,14H,(H2,12,13,15,16) |
| InChIKey | GQNHJUNVCRFLLU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |