C14H17N3O4 — CID 7246411
(2R)-4-(2-cyanoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid (PubChem CID 7246411) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2R)-4-(2-cyanoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid.
| Compound Name | (2R)-4-(2-cyanoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7246411 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2R)-4-(2-cyanoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid |
| SMILES | N#Cc1ccccc1NC(=O)C[C@@H](NCCCO)C(=O)O |
| InChI | InChI=1S/C14H17N3O4/c15-9-10-4-1-2-5-11(10)17-13(19)8-12(14(20)21)16-6-3-7-18/h1-2,4-5,12,16,18H,3,6-8H2,(H,17,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | GOBHRPIYQOJJFE-GFCCVEGCSA-N |
| XLogP | 0.31 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|