C19H25NO5 — CID 7248647
2-O-cyclohexyl 5-O-methyl (5R,6R)-3,6-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2,5-dicarboxylate (PubChem CID 7248647) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-O-cyclohexyl 5-O-methyl (5R,6R)-3,6-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2,5-dicarboxylate.
| Compound Name | 2-O-cyclohexyl 5-O-methyl (5R,6R)-3,6-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 7248647 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-O-cyclohexyl 5-O-methyl (5R,6R)-3,6-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(=O)c2c([nH]c(C(=O)OC3CCCCC3)c2C)C[C@H]1C |
| InChI | InChI=1S/C19H25NO5/c1-10-9-13-15(17(21)14(10)18(22)24-3)11(2)16(20-13)19(23)25-12-7-5-4-6-8-12/h10,12,14,20H,4-9H2,1-3H3/t10-,14-/m1/s1 |
| InChIKey | SOUPFDNQACDAQX-QMTHXVAHSA-N |
| XLogP | 2.98 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|