C21H20N3O4S- — CID 7250771
4-[[2-[(5R)-2-(2,6-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 7250771) has the molecular formula C21H20N3O4S- and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-[[2-[(5R)-2-(2,6-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | 4-[[2-[(5R)-2-(2,6-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7250771 |
| Molecular Formula | C21H20N3O4S- |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-[[2-[(5R)-2-(2,6-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | Cc1cccc(C)c1/N=C1\S[C@H](CC(=O)Nc2ccc(C(=O)[O-])cc2)C(=O)N1C |
| InChI | InChI=1S/C21H21N3O4S/c1-12-5-4-6-13(2)18(12)23-21-24(3)19(26)16(29-21)11-17(25)22-15-9-7-14(8-10-15)20(27)28/h4-10,16H,11H2,1-3H3,(H,22,25)(H,27,28)/p-1/b23-21-/t16-/m1/s1 |
| InChIKey | NNTOWDYTUJAESI-DLTPIXJPSA-M |
| XLogP | 2.26 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|