C26H29NO4S — CID 72519554
ethyl 3-[2-(1-methylsulfonylpiperidin-4-yl)-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]prop-2-enoate (PubChem CID 72519554) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is ethyl 3-[2-(1-methylsulfonylpiperidin-4-yl)-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-(1-methylsulfonylpiperidin-4-yl)-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]prop-2-enoate |
|---|---|
| PubChem CID | 72519554 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | ethyl 3-[2-(1-methylsulfonylpiperidin-4-yl)-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=CC1=Cc2ccccc2C(C2CCN(S(C)(=O)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H29NO4S/c1-3-31-25(28)13-12-21-18-20-8-4-5-10-23(20)26(24-11-7-6-9-22(21)24)19-14-16-27(17-15-19)32(2,29)30/h4-13,18-19,26H,3,14-17H2,1-2H3 |
| InChIKey | KAMQYWOWOPBTJK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|