C25H30O4 — CID 72528393
3-butylidene-6-methyl-6-propylspiro[4,5,5a,7a-tetrahydrocyclobuta[g][2]benzofuran-7,3'-4,5-dihydro-2-benzofuran]-1,1'-dione (PubChem CID 72528393) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 3-butylidene-6-methyl-6-propylspiro[4,5,5a,7a-tetrahydrocyclobuta[g][2]benzofuran-7,3'-4,5-dihydro-2-benzofuran]-1,1'-dione.
| Compound Name | 3-butylidene-6-methyl-6-propylspiro[4,5,5a,7a-tetrahydrocyclobuta[g][2]benzofuran-7,3'-4,5-dihydro-2-benzofuran]-1,1'-dione |
|---|---|
| PubChem CID | 72528393 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-butylidene-6-methyl-6-propylspiro[4,5,5a,7a-tetrahydrocyclobuta[g][2]benzofuran-7,3'-4,5-dihydro-2-benzofuran]-1,1'-dione |
| SMILES | CCCC=C1OC(=O)C2=C1CCC1C2C2(OC(=O)C3=C2CCC=C3)C1(C)CCC |
| InChI | InChI=1S/C25H30O4/c1-4-6-11-19-16-12-13-18-21(20(16)23(27)28-19)25(24(18,3)14-5-2)17-10-8-7-9-15(17)22(26)29-25/h7,9,11,18,21H,4-6,8,10,12-14H2,1-3H3 |
| InChIKey | GDVNIRIDNYBMQI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |