C22H15NO4S — CID 7253090
[2-(1H-indol-3-yl)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate (PubChem CID 7253090) has the molecular formula C22H15NO4S and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 7253090 |
| Molecular Formula | C22H15NO4S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate |
| SMILES | O=C(OCC(=O)c1c[nH]c2ccccc12)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C22H15NO4S/c24-18(16-10-23-17-7-3-1-5-14(16)17)12-27-22(25)20-9-13-11-26-19-8-4-2-6-15(19)21(13)28-20/h1-10,23H,11-12H2 |
| InChIKey | FNLHAANKSCLRPQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |