C8H4F2N2O — CID 72534678
5,8-difluoro-4aH-quinazolin-4-one (PubChem CID 72534678) has the molecular formula C8H4F2N2O and a molecular weight of 182.13 g/mol. Its IUPAC name is 5,8-difluoro-4aH-quinazolin-4-one.
| Compound Name | 5,8-difluoro-4aH-quinazolin-4-one |
|---|---|
| PubChem CID | 72534678 |
| Molecular Formula | C8H4F2N2O |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 5,8-difluoro-4aH-quinazolin-4-one |
| SMILES | O=C1N=CN=C2C(F)=CC=C(F)C12 |
| InChI | InChI=1S/C8H4F2N2O/c9-4-1-2-5(10)7-6(4)8(13)12-3-11-7/h1-3,6H |
| InChIKey | VDOMRCSFJNUCKB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |