C9H6F2N2O — CID 72556741
6,7-difluoro-2-methyl-4aH-quinazolin-4-one (PubChem CID 72556741) has the molecular formula C9H6F2N2O and a molecular weight of 196.16 g/mol. Its IUPAC name is 6,7-difluoro-2-methyl-4aH-quinazolin-4-one.
| Compound Name | 6,7-difluoro-2-methyl-4aH-quinazolin-4-one |
|---|---|
| PubChem CID | 72556741 |
| Molecular Formula | C9H6F2N2O |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 6,7-difluoro-2-methyl-4aH-quinazolin-4-one |
| SMILES | CC1=NC(=O)C2C=C(F)C(F)=CC2=N1 |
| InChI | InChI=1S/C9H6F2N2O/c1-4-12-8-3-7(11)6(10)2-5(8)9(14)13-4/h2-3,5H,1H3 |
| InChIKey | GFPKQVGCFXVCSM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |