C15H20N2O4S — CID 72539502
methyl N-(4-cyclopropylsulfonyl-3-pyrrolidin-2-ylphenyl)carbamate (PubChem CID 72539502) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl N-(4-cyclopropylsulfonyl-3-pyrrolidin-2-ylphenyl)carbamate.
| Compound Name | methyl N-(4-cyclopropylsulfonyl-3-pyrrolidin-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 72539502 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl N-(4-cyclopropylsulfonyl-3-pyrrolidin-2-ylphenyl)carbamate |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)C2CC2)c(C2CCCN2)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-21-15(18)17-10-4-7-14(22(19,20)11-5-6-11)12(9-10)13-3-2-8-16-13/h4,7,9,11,13,16H,2-3,5-6,8H2,1H3,(H,17,18) |
| InChIKey | ZIAFMYJRFRLZCO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |