C17H18N2O — CID 72545788
4-(4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)aniline (PubChem CID 72545788) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)aniline.
| Compound Name | 4-(4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)aniline |
|---|---|
| PubChem CID | 72545788 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-(4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)aniline |
| SMILES | Nc1ccc(C2COc3cccc4c3N2CCC4)cc1 |
| InChI | InChI=1S/C17H18N2O/c18-14-8-6-12(7-9-14)15-11-20-16-5-1-3-13-4-2-10-19(15)17(13)16/h1,3,5-9,15H,2,4,10-11,18H2 |
| InChIKey | LOCWYMSLMPQHMF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|