C21H23F2N3O — CID 72546052
4-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methylamino]butan-1-ol (PubChem CID 72546052) has the molecular formula C21H23F2N3O and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methylamino]butan-1-ol.
| Compound Name | 4-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 72546052 |
| Molecular Formula | C21H23F2N3O |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methylamino]butan-1-ol |
| SMILES | Cc1ccccc1-c1nn(-c2ccc(F)cc2F)cc1CNCCCCO |
| InChI | InChI=1S/C21H23F2N3O/c1-15-6-2-3-7-18(15)21-16(13-24-10-4-5-11-27)14-26(25-21)20-9-8-17(22)12-19(20)23/h2-3,6-9,12,14,24,27H,4-5,10-11,13H2,1H3 |
| InChIKey | LUMPTEIXGWRLQQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|