C23H18ClNO2 — CID 72546124
1-benzyl-3-(4-chlorophenyl)-5-hydroxy-5-phenylpyrrol-2-one (PubChem CID 72546124) has the molecular formula C23H18ClNO2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-5-hydroxy-5-phenylpyrrol-2-one.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-5-hydroxy-5-phenylpyrrol-2-one |
|---|---|
| PubChem CID | 72546124 |
| Molecular Formula | C23H18ClNO2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-5-hydroxy-5-phenylpyrrol-2-one |
| SMILES | O=C1C(c2ccc(Cl)cc2)=CC(O)(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H18ClNO2/c24-20-13-11-18(12-14-20)21-15-23(27,19-9-5-2-6-10-19)25(22(21)26)16-17-7-3-1-4-8-17/h1-15,27H,16H2 |
| InChIKey | MUBBWPMJPJNBMW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |