C33H32O9 — CID 72549228
2-[2-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]cyclohexyl]-1,3,8-trihydroxy-5a,10a-dihydro-[1]benzofuro[3,2-b]chromen-11-one (PubChem CID 72549228) has the molecular formula C33H32O9 and a molecular weight of 572.61 g/mol. Its IUPAC name is 2-[2-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]cyclohexyl]-1,3,8-trihydroxy-5a,10a-dihydro-[1]benzofuro[3,2-b]chromen-11-one.
| Compound Name | 2-[2-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]cyclohexyl]-1,3,8-trihydroxy-5a,10a-dihydro-[1]benzofuro[3,2-b]chromen-11-one |
|---|---|
| PubChem CID | 72549228 |
| Molecular Formula | C33H32O9 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 2-[2-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]cyclohexyl]-1,3,8-trihydroxy-5a,10a-dihydro-[1]benzofuro[3,2-b]chromen-11-one |
| SMILES | CC(C)=CCc1c(O)ccc(C(=O)C2CCCCC2c2c(O)cc3c(c2O)C(=O)C2Oc4cc(O)ccc4C2O3)c1O |
| InChI | InChI=1S/C33H32O9/c1-15(2)7-9-19-22(35)12-11-21(29(19)38)28(37)18-6-4-3-5-17(18)26-23(36)14-25-27(30(26)39)31(40)33-32(42-25)20-10-8-16(34)13-24(20)41-33/h7-8,10-14,17-18,32-36,38-39H,3-6,9H2,1-2H3 |
| InChIKey | OFBHHBDWJLKOAN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|