C19H21ClFNO4 — CID 72558474
2-(3-chloro-4-fluorophenoxy)-N-hydroxy-6-phenylmethoxyhexanamide (PubChem CID 72558474) has the molecular formula C19H21ClFNO4 and a molecular weight of 381.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenoxy)-N-hydroxy-6-phenylmethoxyhexanamide.
| Compound Name | 2-(3-chloro-4-fluorophenoxy)-N-hydroxy-6-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 72558474 |
| Molecular Formula | C19H21ClFNO4 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-(3-chloro-4-fluorophenoxy)-N-hydroxy-6-phenylmethoxyhexanamide |
| SMILES | O=C(NO)C(CCCCOCc1ccccc1)Oc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClFNO4/c20-16-12-15(9-10-17(16)21)26-18(19(23)22-24)8-4-5-11-25-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12,18,24H,4-5,8,11,13H2,(H,22,23) |
| InChIKey | RSCOCUQVVJPKLR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|