C23H25F3O6 — CID 155584910
dimethyl 4-(1,1,1-trifluoro-6-phenylmethoxyhexan-2-yl)oxybenzene-1,2-dicarboxylate (PubChem CID 155584910) has the molecular formula C23H25F3O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is dimethyl 4-(1,1,1-trifluoro-6-phenylmethoxyhexan-2-yl)oxybenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(1,1,1-trifluoro-6-phenylmethoxyhexan-2-yl)oxybenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155584910 |
| Molecular Formula | C23H25F3O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | dimethyl 4-(1,1,1-trifluoro-6-phenylmethoxyhexan-2-yl)oxybenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OC(CCCCOCc2ccccc2)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C23H25F3O6/c1-29-21(27)18-12-11-17(14-19(18)22(28)30-2)32-20(23(24,25)26)10-6-7-13-31-15-16-8-4-3-5-9-16/h3-5,8-9,11-12,14,20H,6-7,10,13,15H2,1-2H3 |
| InChIKey | PPFYGRBHKBVOFO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|