C14H18N4O4 — CID 72565126
2-[[3-[4-[(acetylhydrazinylidene)methyl]phenyl]-2-aminopropanoyl]amino]acetic acid (PubChem CID 72565126) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[[3-[4-[(acetylhydrazinylidene)methyl]phenyl]-2-aminopropanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[4-[(acetylhydrazinylidene)methyl]phenyl]-2-aminopropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 72565126 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[[3-[4-[(acetylhydrazinylidene)methyl]phenyl]-2-aminopropanoyl]amino]acetic acid |
| SMILES | CC(=O)NN=Cc1ccc(CC(N)C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N4O4/c1-9(19)18-17-7-11-4-2-10(3-5-11)6-12(15)14(22)16-8-13(20)21/h2-5,7,12H,6,8,15H2,1H3,(H,16,22)(H,18,19)(H,20,21) |
| InChIKey | AYCRKCJPDGJTSV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|