C22H25BrFNO3 — CID 72570936
tert-butyl N-[4-[2-[3-bromo-4-(2-fluoroethoxy)phenyl]ethenyl]phenyl]-N-methylcarbamate (PubChem CID 72570936) has the molecular formula C22H25BrFNO3 and a molecular weight of 450.35 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[3-bromo-4-(2-fluoroethoxy)phenyl]ethenyl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[2-[3-bromo-4-(2-fluoroethoxy)phenyl]ethenyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 72570936 |
| Molecular Formula | C22H25BrFNO3 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | tert-butyl N-[4-[2-[3-bromo-4-(2-fluoroethoxy)phenyl]ethenyl]phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(C=Cc2ccc(OCCF)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H25BrFNO3/c1-22(2,3)28-21(26)25(4)18-10-7-16(8-11-18)5-6-17-9-12-20(19(23)15-17)27-14-13-24/h5-12,15H,13-14H2,1-4H3 |
| InChIKey | LRVQUOWIKUFJSG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|