C19H21FN2O2 — CID 77426644
tert-butyl N-[4-[2-(2-fluoro-3-pyridinyl)ethenyl]phenyl]-N-methylcarbamate (PubChem CID 77426644) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(2-fluoro-3-pyridinyl)ethenyl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[2-(2-fluoro-3-pyridinyl)ethenyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 77426644 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | tert-butyl N-[4-[2-(2-fluoro-3-pyridinyl)ethenyl]phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(C=Cc2cccnc2F)cc1 |
| InChI | InChI=1S/C19H21FN2O2/c1-19(2,3)24-18(23)22(4)16-11-8-14(9-12-16)7-10-15-6-5-13-21-17(15)20/h5-13H,1-4H3 |
| InChIKey | BFXQGTYIOUMXHH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|