C21H13F5N4O — CID 72586349
N-[[2-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-yl]-(4-fluorophenyl)methylidene]hydroxylamine (PubChem CID 72586349) has the molecular formula C21H13F5N4O and a molecular weight of 432.35 g/mol. Its IUPAC name is N-[[2-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-yl]-(4-fluorophenyl)methylidene]hydroxylamine.
| Compound Name | N-[[2-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-yl]-(4-fluorophenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 72586349 |
| Molecular Formula | C21H13F5N4O |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[[2-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-yl]-(4-fluorophenyl)methylidene]hydroxylamine |
| SMILES | Nc1nc2ccc(C(=NO)c3ccc(F)cc3)cn2c1-c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C21H13F5N4O/c22-14-5-1-11(2-6-14)18(29-31)12-3-8-17-28-20(27)19(30(17)10-12)15-7-4-13(9-16(15)23)21(24,25)26/h1-10,31H,27H2 |
| InChIKey | AOBFBCPQNDQMQW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|